C10H16N2S — CID 106181412
2-[(3-methylbut-2-enylamino)methyl]thiophen-3-amine (PubChem CID 106181412) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-[(3-methylbut-2-enylamino)methyl]thiophen-3-amine.
| Compound Name | 2-[(3-methylbut-2-enylamino)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 106181412 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-[(3-methylbut-2-enylamino)methyl]thiophen-3-amine |
| SMILES | CC(C)=CCNCc1sccc1N |
| InChI | InChI=1S/C10H16N2S/c1-8(2)3-5-12-7-10-9(11)4-6-13-10/h3-4,6,12H,5,7,11H2,1-2H3 |
| InChIKey | KMYGDXHEKMMAIQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|