C15H22N2O3S — CID 10267407
[1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]methyl 3-ethoxy-3-iminopropanoate (PubChem CID 10267407) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is [1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]methyl 3-ethoxy-3-iminopropanoate.
| Compound Name | [1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]methyl 3-ethoxy-3-iminopropanoate |
|---|---|
| PubChem CID | 10267407 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]methyl 3-ethoxy-3-iminopropanoate |
| SMILES | [H]/N=C(/CC(=O)OCC1CCN(Cc2cccs2)C1)OCC |
| InChI | InChI=1S/C15H22N2O3S/c1-2-19-14(16)8-15(18)20-11-12-5-6-17(9-12)10-13-4-3-7-21-13/h3-4,7,12,16H,2,5-6,8-11H2,1H3/b16-14- |
| InChIKey | QUUPLHLARLXCBQ-PEZBUJJGSA-N |
| XLogP | 2.52 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|