C11H13F3NO4P — CID 10267440
[methoxy-[[(1R)-1-phenylethyl]amino]phosphoryl] 2,2,2-trifluoroacetate (PubChem CID 10267440) has the molecular formula C11H13F3NO4P and a molecular weight of 311.20 g/mol. Its IUPAC name is [methoxy-[[(1R)-1-phenylethyl]amino]phosphoryl] 2,2,2-trifluoroacetate.
| Compound Name | [methoxy-[[(1R)-1-phenylethyl]amino]phosphoryl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10267440 |
| Molecular Formula | C11H13F3NO4P |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | [methoxy-[[(1R)-1-phenylethyl]amino]phosphoryl] 2,2,2-trifluoroacetate |
| SMILES | CO[P@](=O)(N[C@H](C)c1ccccc1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H13F3NO4P/c1-8(9-6-4-3-5-7-9)15-20(17,18-2)19-10(16)11(12,13)14/h3-8H,1-2H3,(H,15,17)/t8-,20-/m1/s1 |
| InChIKey | FKNRTZZPDQKPFF-ZPWHCFADSA-N |
| XLogP | 3.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|