C10H24N2O3S — CID 102676267
2-[(4-methoxy-4-methylpentan-2-yl)amino]-N-methylethanesulfonamide (PubChem CID 102676267) has the molecular formula C10H24N2O3S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-[(4-methoxy-4-methylpentan-2-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(4-methoxy-4-methylpentan-2-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102676267 |
| Molecular Formula | C10H24N2O3S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[(4-methoxy-4-methylpentan-2-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNC(C)CC(C)(C)OC |
| InChI | InChI=1S/C10H24N2O3S/c1-9(8-10(2,3)15-5)12-6-7-16(13,14)11-4/h9,11-12H,6-8H2,1-5H3 |
| InChIKey | XESWFWNYRWDREK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |