C11H26N2O3S — CID 75515328
N-ethyl-2-[(4-methoxy-4-methylpentan-2-yl)amino]ethanesulfonamide (PubChem CID 75515328) has the molecular formula C11H26N2O3S and a molecular weight of 266.41 g/mol. Its IUPAC name is N-ethyl-2-[(4-methoxy-4-methylpentan-2-yl)amino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[(4-methoxy-4-methylpentan-2-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 75515328 |
| Molecular Formula | C11H26N2O3S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-ethyl-2-[(4-methoxy-4-methylpentan-2-yl)amino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNC(C)CC(C)(C)OC |
| InChI | InChI=1S/C11H26N2O3S/c1-6-13-17(14,15)8-7-12-10(2)9-11(3,4)16-5/h10,12-13H,6-9H2,1-5H3 |
| InChIKey | DZVWTFQYHICEDV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |