C14H22N2O — CID 102678989
(4aS,7aS)-6-[1-(furan-2-yl)propyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102678989) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (4aS,7aS)-6-[1-(furan-2-yl)propyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-[1-(furan-2-yl)propyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102678989 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (4aS,7aS)-6-[1-(furan-2-yl)propyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | CCC(c1ccco1)N1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C14H22N2O/c1-2-13(14-6-4-8-17-14)16-9-11-5-3-7-15-12(11)10-16/h4,6,8,11-13,15H,2-3,5,7,9-10H2,1H3/t11-,12+,13?/m0/s1 |
| InChIKey | NXBJBOFLAJOWAW-LAGVYOHYSA-N |
| XLogP | 2.41 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |