C18H30N2S — CID 64942493
3-cyclohexyl-1-(1-thiophen-2-ylpropyl)-1,4-diazepane (PubChem CID 64942493) has the molecular formula C18H30N2S and a molecular weight of 306.52 g/mol. Its IUPAC name is 3-cyclohexyl-1-(1-thiophen-2-ylpropyl)-1,4-diazepane.
| Compound Name | 3-cyclohexyl-1-(1-thiophen-2-ylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64942493 |
| Molecular Formula | C18H30N2S |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-cyclohexyl-1-(1-thiophen-2-ylpropyl)-1,4-diazepane |
| SMILES | CCC(c1cccs1)N1CCCNC(C2CCCCC2)C1 |
| InChI | InChI=1S/C18H30N2S/c1-2-17(18-10-6-13-21-18)20-12-7-11-19-16(14-20)15-8-4-3-5-9-15/h6,10,13,15-17,19H,2-5,7-9,11-12,14H2,1H3 |
| InChIKey | LFCMGUVFUYWVLZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |