C17H28N2S — CID 64944577
3-cyclohexyl-1-(1-thiophen-2-ylethyl)-1,4-diazepane (PubChem CID 64944577) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 3-cyclohexyl-1-(1-thiophen-2-ylethyl)-1,4-diazepane.
| Compound Name | 3-cyclohexyl-1-(1-thiophen-2-ylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64944577 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 3-cyclohexyl-1-(1-thiophen-2-ylethyl)-1,4-diazepane |
| SMILES | CC(c1cccs1)N1CCCNC(C2CCCCC2)C1 |
| InChI | InChI=1S/C17H28N2S/c1-14(17-9-5-12-20-17)19-11-6-10-18-16(13-19)15-7-3-2-4-8-15/h5,9,12,14-16,18H,2-4,6-8,10-11,13H2,1H3 |
| InChIKey | MAAPYJDWKOOQNG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |