C17H24F2N2 — CID 60978666
1-[1-(2,6-difluorophenyl)ethyl]-3-pyrrolidin-2-ylpiperidine (PubChem CID 60978666) has the molecular formula C17H24F2N2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[1-(2,6-difluorophenyl)ethyl]-3-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-[1-(2,6-difluorophenyl)ethyl]-3-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 60978666 |
| Molecular Formula | C17H24F2N2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[1-(2,6-difluorophenyl)ethyl]-3-pyrrolidin-2-ylpiperidine |
| SMILES | CC(c1c(F)cccc1F)N1CCCC(C2CCCN2)C1 |
| InChI | InChI=1S/C17H24F2N2/c1-12(17-14(18)6-2-7-15(17)19)21-10-4-5-13(11-21)16-8-3-9-20-16/h2,6-7,12-13,16,20H,3-5,8-11H2,1H3 |
| InChIKey | UMLMIGKQWLWXIU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |