C15H21F2N — CID 98764853
(3S)-1-[(1R)-1-(2,6-difluorophenyl)ethyl]-3-ethylpiperidine (PubChem CID 98764853) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is (3S)-1-[(1R)-1-(2,6-difluorophenyl)ethyl]-3-ethylpiperidine.
| Compound Name | (3S)-1-[(1R)-1-(2,6-difluorophenyl)ethyl]-3-ethylpiperidine |
|---|---|
| PubChem CID | 98764853 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (3S)-1-[(1R)-1-(2,6-difluorophenyl)ethyl]-3-ethylpiperidine |
| SMILES | CC[C@H]1CCCN([C@H](C)c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C15H21F2N/c1-3-12-6-5-9-18(10-12)11(2)15-13(16)7-4-8-14(15)17/h4,7-8,11-12H,3,5-6,9-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | WTUFKUGXDYGWLD-NEPJUHHUSA-N |
| XLogP | 4.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |