C15H23N3OS — CID 102683153
2-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 102683153) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 102683153 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)CN1C[C@@H]2CCCN[C@@H]2C1)c1cccs1 |
| InChI | InChI=1S/C15H23N3OS/c1-11(14-5-3-7-20-14)17-15(19)10-18-8-12-4-2-6-16-13(12)9-18/h3,5,7,11-13,16H,2,4,6,8-10H2,1H3,(H,17,19)/t11?,12-,13+/m0/s1 |
| InChIKey | ACAZMUOVVITALX-LWNNLKQOSA-N |
| XLogP | 1.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |