C16H21N3O2 — CID 102682485
N-[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]benzamide (PubChem CID 102682485) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]benzamide.
| Compound Name | N-[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]benzamide |
|---|---|
| PubChem CID | 102682485 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[2-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)acetyl]benzamide |
| SMILES | O=C(CN1CC2CCCNC2C1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O2/c20-15(18-16(21)12-5-2-1-3-6-12)11-19-9-13-7-4-8-17-14(13)10-19/h1-3,5-6,13-14,17H,4,7-11H2,(H,18,20,21) |
| InChIKey | CSNDJKZEYLWVGC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |