C16H25NO2S — CID 83198545
2-methyl-2-[1-(1-thiophen-2-ylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 83198545) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-methyl-2-[1-(1-thiophen-2-ylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 2-methyl-2-[1-(1-thiophen-2-ylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 83198545 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-methyl-2-[1-(1-thiophen-2-ylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | CCC(c1cccs1)N1CCCC(C(C)(C)C(=O)O)C1 |
| InChI | InChI=1S/C16H25NO2S/c1-4-13(14-8-6-10-20-14)17-9-5-7-12(11-17)16(2,3)15(18)19/h6,8,10,12-13H,4-5,7,9,11H2,1-3H3,(H,18,19) |
| InChIKey | KKCIPBQTPNZTQZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |