C15H20N2OS — CID 102679677
[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone (PubChem CID 102679677) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone.
| Compound Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 102679677 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)CCC2)N1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C15H20N2OS/c18-15(14-7-10-3-1-5-13(10)19-14)17-8-11-4-2-6-16-12(11)9-17/h7,11-12,16H,1-6,8-9H2/t11-,12+/m0/s1 |
| InChIKey | INBXBWJHMOMYHA-NWDGAFQWSA-N |
| XLogP | 2.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |