C18H24N2OS — CID 124743879
[(3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone (PubChem CID 124743879) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is [(3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone.
| Compound Name | [(3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 124743879 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [(3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)CCC2)N1C[C@@H]2CN3CCCC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C18H24N2OS/c21-18(17-8-12-4-3-6-16(12)22-17)20-10-13-9-19-7-2-1-5-15(19)14(13)11-20/h8,13-15H,1-7,9-11H2/t13-,14+,15-/m0/s1 |
| InChIKey | ZGBGTYGDPXRPQX-ZNMIVQPWSA-N |
| XLogP | 2.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |