C20H34O3 — CID 10268093
(6Z,9S,12Z,15Z)-9-hydroxyicosa-6,12,15-trienoic acid (PubChem CID 10268093) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (6Z,9S,12Z,15Z)-9-hydroxyicosa-6,12,15-trienoic acid.
| Compound Name | (6Z,9S,12Z,15Z)-9-hydroxyicosa-6,12,15-trienoic acid |
|---|---|
| PubChem CID | 10268093 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (6Z,9S,12Z,15Z)-9-hydroxyicosa-6,12,15-trienoic acid |
| SMILES | CCCC/C=C\C/C=C\CC[C@H](O)C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-5-6-7-8-10-13-16-19(21)17-14-11-9-12-15-18-20(22)23/h5-6,8,10-11,14,19,21H,2-4,7,9,12-13,15-18H2,1H3,(H,22,23)/b6-5-,10-8-,14-11-/t19-/m0/s1 |
| InChIKey | VMYMZVBNBHWBHE-HRGPVENRSA-N |
| XLogP | 5.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|