C15H25N5O3 — CID 10268122
3-[(5R)-5-hydroxyhexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione (PubChem CID 10268122) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[(5R)-5-hydroxyhexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 3-[(5R)-5-hydroxyhexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10268122 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-[(5R)-5-hydroxyhexyl]-1-methyl-4a,6,7,8,10,10a-hexahydropurino[7,8-a]pyrimidine-2,4-dione |
| SMILES | C[C@@H](O)CCCCN1C(=O)C2C(NC3=NCCCN32)N(C)C1=O |
| InChI | InChI=1S/C15H25N5O3/c1-10(21)6-3-4-8-20-13(22)11-12(18(2)15(20)23)17-14-16-7-5-9-19(11)14/h10-12,21H,3-9H2,1-2H3,(H,16,17)/t10-,11?,12?/m1/s1 |
| InChIKey | MSDNLCQMMXKOQR-VOMCLLRMSA-N |
| XLogP | -0.21 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|