C15H26N2O4S — CID 10268430
tert-butyl 2-[[(4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl]amino]acetate (PubChem CID 10268430) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is tert-butyl 2-[[(4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 10268430 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | tert-butyl 2-[[(4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carbonyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@@H]1N(C=O)C(C)(C)SC1(C)C |
| InChI | InChI=1S/C15H26N2O4S/c1-13(2,3)21-10(19)8-16-12(20)11-14(4,5)22-15(6,7)17(11)9-18/h9,11H,8H2,1-7H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | WADDHIROGSOJAX-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|