C13H22N2O5S — CID 504548
ethyl 2-(2-ethoxy-1-formamido-2-oxoethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 504548) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is ethyl 2-(2-ethoxy-1-formamido-2-oxoethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | ethyl 2-(2-ethoxy-1-formamido-2-oxoethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 504548 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl 2-(2-ethoxy-1-formamido-2-oxoethyl)-5,5-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)C(NC=O)C1NC(C(=O)OCC)C(C)(C)S1 |
| InChI | InChI=1S/C13H22N2O5S/c1-5-19-11(17)8(14-7-16)10-15-9(12(18)20-6-2)13(3,4)21-10/h7-10,15H,5-6H2,1-4H3,(H,14,16) |
| InChIKey | MXIQGNBBQIJFIZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|