C15H24N2O5S — CID 24747497
dipropyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate (PubChem CID 24747497) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is dipropyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate.
| Compound Name | dipropyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 24747497 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | dipropyl (7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
| SMILES | CCCOC(=O)C1NC(=O)N2C(C(=O)OCCC)C(C)(C)S[C@H]12 |
| InChI | InChI=1S/C15H24N2O5S/c1-5-7-21-12(18)9-11-17(14(20)16-9)10(15(3,4)23-11)13(19)22-8-6-2/h9-11H,5-8H2,1-4H3,(H,16,20)/t9?,10?,11-/m1/s1 |
| InChIKey | HOROARFPHFSYJN-VQXHTEKXSA-N |
| XLogP | 1.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |