C9H10N2Na2O5S — CID 25011528
disodium;(7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate (PubChem CID 25011528) has the molecular formula C9H10N2Na2O5S and a molecular weight of 304.24 g/mol. Its IUPAC name is disodium;(7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate.
| Compound Name | disodium;(7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 25011528 |
| Molecular Formula | C9H10N2Na2O5S |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | disodium;(7aR)-2,2-dimethyl-5-oxo-3,6,7,7a-tetrahydroimidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
| SMILES | CC1(C)S[C@@H]2C(C(=O)[O-])NC(=O)N2C1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H12N2O5S.2Na/c1-9(2)4(7(14)15)11-5(17-9)3(6(12)13)10-8(11)16;;/h3-5H,1-2H3,(H,10,16)(H,12,13)(H,14,15);;/q;2*+1/p-2/t3?,4?,5-;;/m1../s1 |
| InChIKey | MWYFDXUUGGPMOL-KCXVJVQUSA-L |
| XLogP | -8.89 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | -8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |