C12H18N2O5S — CID 156602451
dimethyl (3S,7R,7aR)-2,2,6-trimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate (PubChem CID 156602451) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is dimethyl (3S,7R,7aR)-2,2,6-trimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate.
| Compound Name | dimethyl (3S,7R,7aR)-2,2,6-trimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
|---|---|
| PubChem CID | 156602451 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | dimethyl (3S,7R,7aR)-2,2,6-trimethyl-5-oxo-7,7a-dihydro-3H-imidazo[5,1-b][1,3]thiazole-3,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2SC(C)(C)[C@H](C(=O)OC)N2C(=O)N1C |
| InChI | InChI=1S/C12H18N2O5S/c1-12(2)7(10(16)19-5)14-8(20-12)6(9(15)18-4)13(3)11(14)17/h6-8H,1-5H3/t6-,7-,8+/m0/s1 |
| InChIKey | NCJDADUBNOLJBE-BIIVOSGPSA-N |
| XLogP | 0.29 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |