C12H13N3S — CID 102686679
N-cyclopent-3-en-1-yl-7-methylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 102686679) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-7-methylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-cyclopent-3-en-1-yl-7-methylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 102686679 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-cyclopent-3-en-1-yl-7-methylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1csc2c(NC3CC=CC3)ncnc12 |
| InChI | InChI=1S/C12H13N3S/c1-8-6-16-11-10(8)13-7-14-12(11)15-9-4-2-3-5-9/h2-3,6-7,9H,4-5H2,1H3,(H,13,14,15) |
| InChIKey | LOIUKFMYJNHCIU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|