C13H21B2N3O6 — CID 10268690
[2-borono-4-[(6-hydrazinyl-6-oxohexyl)carbamoyl]phenyl]boronic acid (PubChem CID 10268690) has the molecular formula C13H21B2N3O6 and a molecular weight of 336.95 g/mol. Its IUPAC name is [2-borono-4-[(6-hydrazinyl-6-oxohexyl)carbamoyl]phenyl]boronic acid.
| Compound Name | [2-borono-4-[(6-hydrazinyl-6-oxohexyl)carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 10268690 |
| Molecular Formula | C13H21B2N3O6 |
| Molecular Weight | 336.95 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [2-borono-4-[(6-hydrazinyl-6-oxohexyl)carbamoyl]phenyl]boronic acid |
| SMILES | NNC(=O)CCCCCNC(=O)c1ccc(B(O)O)c(B(O)O)c1 |
| InChI | InChI=1S/C13H21B2N3O6/c16-18-12(19)4-2-1-3-7-17-13(20)9-5-6-10(14(21)22)11(8-9)15(23)24/h5-6,8,21-24H,1-4,7,16H2,(H,17,20)(H,18,19) |
| InChIKey | WREMJCKXXSPQKX-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.95 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|