C9H11N3S — CID 102687222
2-(7-methylthieno[3,2-d]pyrimidin-4-yl)ethanamine (PubChem CID 102687222) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)ethanamine.
| Compound Name | 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)ethanamine |
|---|---|
| PubChem CID | 102687222 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-(7-methylthieno[3,2-d]pyrimidin-4-yl)ethanamine |
| SMILES | Cc1csc2c(CCN)ncnc12 |
| InChI | InChI=1S/C9H11N3S/c1-6-4-13-9-7(2-3-10)11-5-12-8(6)9/h4-5H,2-3,10H2,1H3 |
| InChIKey | JUYFDZZPPUMQCV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |