C12H20N2S — CID 143718970
4,7-dimethylthieno[3,2-d]pyrimidine;ethane (PubChem CID 143718970) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 4,7-dimethylthieno[3,2-d]pyrimidine;ethane.
| Compound Name | 4,7-dimethylthieno[3,2-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 143718970 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4,7-dimethylthieno[3,2-d]pyrimidine;ethane |
| SMILES | CC.CC.Cc1csc2c(C)ncnc12 |
| InChI | InChI=1S/C8H8N2S.2C2H6/c1-5-3-11-8-6(2)9-4-10-7(5)8;2*1-2/h3-4H,1-2H3;2*1-2H3 |
| InChIKey | XPBNCLFXISAKTL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |