C8H10N4S — CID 146460535
1-methyl-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazine (PubChem CID 146460535) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 1-methyl-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazine.
| Compound Name | 1-methyl-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 146460535 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 1-methyl-1-(7-methylthieno[3,2-d]pyrimidin-4-yl)hydrazine |
| SMILES | Cc1csc2c(N(C)N)ncnc12 |
| InChI | InChI=1S/C8H10N4S/c1-5-3-13-7-6(5)10-4-11-8(7)12(2)9/h3-4H,9H2,1-2H3 |
| InChIKey | UDEPVQRLKBRQKF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|