5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid

C12H19NO5 — CID 102688484

IUPAC5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid
SMILESCC1CN(C(=O)C2CCC(C(=O)O)O2)CCCO1
InChIInChI=1S/C12H19NO5/c1-8-7-13(5-2-6-17-8)11(14)9-3-4-10(18-9)12(15)16/h8-10H,2-7H2,1H3,(H,15,16)
InChIKeyCFDNJOVBQDNMEC-UHFFFAOYSA-N
MW257.29 g/mol
LogP0.26
Rot. Bonds2

About 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid

5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid (PubChem CID 102688484) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid.

Molecular Properties

Compound Name5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid
PubChem CID102688484
Molecular FormulaC12H19NO5
Molecular Weight257.29 g/mol
Exact Mass257.13
IUPAC Name5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid
SMILESCC1CN(C(=O)C2CCC(C(=O)O)O2)CCCO1
InChIInChI=1S/C12H19NO5/c1-8-7-13(5-2-6-17-8)11(14)9-3-4-10(18-9)12(15)16/h8-10H,2-7H2,1H3,(H,15,16)
InChIKeyCFDNJOVBQDNMEC-UHFFFAOYSA-N
XLogP0.26
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 50.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid?
The IUPAC name of 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid (CID 102688484) is 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid.
What is the SMILES notation for 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid?
The canonical SMILES for 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid is CC1CN(C(=O)C2CCC(C(=O)O)O2)CCCO1.
What is the InChIKey of 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid?
The InChIKey is CFDNJOVBQDNMEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5/c1-8-7-13(5-2-6-17-8)11(14)9-3-4-10(18-9)12(15)16/h8-10H,2-7H2,1H3,(H,15,16).
What are the key properties of 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid?
5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid has a molecular weight of 257.29 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,4-oxazepane-4-carbonyl)oxolane-2-carboxylic acid is sourced from PubChem (CID 102688484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).