C11H10BrNO3S — CID 102689780
3-[(4-bromothiophen-2-yl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 102689780) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[(4-bromothiophen-2-yl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 102689780 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methyl]-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C1C2CCC(O2)C(=O)N1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H10BrNO3S/c12-6-3-7(17-5-6)4-13-10(14)8-1-2-9(16-8)11(13)15/h3,5,8-9H,1-2,4H2 |
| InChIKey | KGDBXYBJEJMXDS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|