C12H12BrNO2S — CID 103979624
2-[(4-bromothiophen-2-yl)methyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 103979624) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 103979624 |
| Molecular Formula | C12H12BrNO2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | O=C1C2CCCC2C(=O)N1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H12BrNO2S/c13-7-4-8(17-6-7)5-14-11(15)9-2-1-3-10(9)12(14)16/h4,6,9-10H,1-3,5H2 |
| InChIKey | LZRWCXVLNFAWMN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|