C11H15Br2NS — CID 130757002
3-bromo-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperidine (PubChem CID 130757002) has the molecular formula C11H15Br2NS and a molecular weight of 353.12 g/mol. Its IUPAC name is 3-bromo-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperidine.
| Compound Name | 3-bromo-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 130757002 |
| Molecular Formula | C11H15Br2NS |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 3-bromo-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperidine |
| SMILES | CC1C(Br)CCCN1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H15Br2NS/c1-8-11(13)3-2-4-14(8)6-10-5-9(12)7-15-10/h5,7-8,11H,2-4,6H2,1H3 |
| InChIKey | OEYAXKXEHJEFGJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|