C10H14BrNOS2 — CID 131115045
[4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]methanol (PubChem CID 131115045) has the molecular formula C10H14BrNOS2 and a molecular weight of 308.27 g/mol. Its IUPAC name is [4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]methanol.
| Compound Name | [4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]methanol |
|---|---|
| PubChem CID | 131115045 |
| Molecular Formula | C10H14BrNOS2 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | [4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]methanol |
| SMILES | OCC1CSCCN1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H14BrNOS2/c11-8-3-10(15-6-8)4-12-1-2-14-7-9(12)5-13/h3,6,9,13H,1-2,4-5,7H2 |
| InChIKey | NEMLRFNTKANGLW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |