C10H13BrN2S — CID 131123705
2-[(4-bromothiophen-2-yl)methyl]-2-azabicyclo[2.1.1]hexan-5-amine (PubChem CID 131123705) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-2-azabicyclo[2.1.1]hexan-5-amine.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-2-azabicyclo[2.1.1]hexan-5-amine |
|---|---|
| PubChem CID | 131123705 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-2-azabicyclo[2.1.1]hexan-5-amine |
| SMILES | NC1C2CC1N(Cc1cc(Br)cs1)C2 |
| InChI | InChI=1S/C10H13BrN2S/c11-7-2-8(14-5-7)4-13-3-6-1-9(13)10(6)12/h2,5-6,9-10H,1,3-4,12H2 |
| InChIKey | KSSHXNHCJOHKNX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |