C10H15BrN2S — CID 82705689
(2S)-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine (PubChem CID 82705689) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is (2S)-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine.
| Compound Name | (2S)-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 82705689 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (2S)-1-[(4-bromothiophen-2-yl)methyl]-2-methylpiperazine |
| SMILES | C[C@H]1CNCCN1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H15BrN2S/c1-8-5-12-2-3-13(8)6-10-4-9(11)7-14-10/h4,7-8,12H,2-3,5-6H2,1H3/t8-/m0/s1 |
| InChIKey | GQMUKFRQCSLLDL-QMMMGPOBSA-N |
| XLogP | 2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |