C10H14BrClN2S — CID 120837065
1-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylpiperazine (PubChem CID 120837065) has the molecular formula C10H14BrClN2S and a molecular weight of 309.66 g/mol. Its IUPAC name is 1-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylpiperazine.
| Compound Name | 1-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 120837065 |
| Molecular Formula | C10H14BrClN2S |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 1-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-methylpiperazine |
| SMILES | CC1CNCCN1Cc1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C10H14BrClN2S/c1-7-5-13-2-3-14(7)6-8-4-9(11)10(12)15-8/h4,7,13H,2-3,5-6H2,1H3 |
| InChIKey | LGQHWCNFNILENX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |