C13H19BrN2 — CID 83558611
1-[(5-bromo-2-methylphenyl)methyl]-2-methylpiperazine (PubChem CID 83558611) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 1-[(5-bromo-2-methylphenyl)methyl]-2-methylpiperazine.
| Compound Name | 1-[(5-bromo-2-methylphenyl)methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 83558611 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[(5-bromo-2-methylphenyl)methyl]-2-methylpiperazine |
| SMILES | Cc1ccc(Br)cc1CN1CCNCC1C |
| InChI | InChI=1S/C13H19BrN2/c1-10-3-4-13(14)7-12(10)9-16-6-5-15-8-11(16)2/h3-4,7,11,15H,5-6,8-9H2,1-2H3 |
| InChIKey | IDHVFWBIXRZCMW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |