About (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine
(2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine (PubChem CID 82761273) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine.
Molecular Properties
| Compound Name | (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine |
| PubChem CID | 82761273 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CN1CCNC[C@H]1C |
| InChI | InChI=1S/C18H30N2/c1-13-9-16(18(4,5)6)10-14(2)17(13)12-20-8-7-19-11-15(20)3/h9-10,15,19H,7-8,11-12H2,1-6H3/t15-/m1/s1 |
| InChIKey | ZXMFLUHVYWKTEK-OAHLLOKOSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine?
The IUPAC name of (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine (CID 82761273) is (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine.
What is the SMILES notation for (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine?
The canonical SMILES for (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine is Cc1cc(C(C)(C)C)cc(C)c1CN1CCNC[C@H]1C.
What is the InChIKey of (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine?
The InChIKey is ZXMFLUHVYWKTEK-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H30N2/c1-13-9-16(18(4,5)6)10-14(2)17(13)12-20-8-7-19-11-15(20)3/h9-10,15,19H,7-8,11-12H2,1-6H3/t15-/m1/s1.
What are the key properties of (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine?
(2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine has a molecular weight of 274.45 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-2-methylpiperazine is sourced from PubChem (CID 82761273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).