C13H19BrN2O2S — CID 110898936
N-[(4-bromothiophen-2-yl)methyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide (PubChem CID 110898936) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110898936 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-[2-(hydroxymethyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCCC1CO)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H19BrN2O2S/c14-10-5-12(19-9-10)6-15-13(18)7-16-4-2-1-3-11(16)8-17/h5,9,11,17H,1-4,6-8H2,(H,15,18) |
| InChIKey | ZNBOVLBOZVFARO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |