C12H15BrN2O3S — CID 125149797
(2S)-1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid (PubChem CID 125149797) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is (2S)-1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 125149797 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | (2S)-1-[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(CN1CCC[C@H]1C(=O)O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H15BrN2O3S/c13-8-4-9(19-7-8)5-14-11(16)6-15-3-1-2-10(15)12(17)18/h4,7,10H,1-3,5-6H2,(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | UWQREKHUHLXFTR-JTQLQIEISA-N |
| XLogP | 1.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |