C10H14BrNO2S — CID 131186323
[4-[(5-bromofuran-3-yl)methyl]thiomorpholin-3-yl]methanol (PubChem CID 131186323) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is [4-[(5-bromofuran-3-yl)methyl]thiomorpholin-3-yl]methanol.
| Compound Name | [4-[(5-bromofuran-3-yl)methyl]thiomorpholin-3-yl]methanol |
|---|---|
| PubChem CID | 131186323 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | [4-[(5-bromofuran-3-yl)methyl]thiomorpholin-3-yl]methanol |
| SMILES | OCC1CSCCN1Cc1coc(Br)c1 |
| InChI | InChI=1S/C10H14BrNO2S/c11-10-3-8(6-14-10)4-12-1-2-15-7-9(12)5-13/h3,6,9,13H,1-2,4-5,7H2 |
| InChIKey | HJQWHORABILQMN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |