C11H14BrNO2S2 — CID 66444765
2-[4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66444765) has the molecular formula C11H14BrNO2S2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-[4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66444765 |
| Molecular Formula | C11H14BrNO2S2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 2-[4-[(4-bromothiophen-2-yl)methyl]thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H14BrNO2S2/c12-8-3-10(17-6-8)5-13-1-2-16-7-9(13)4-11(14)15/h3,6,9H,1-2,4-5,7H2,(H,14,15) |
| InChIKey | SKGVRNBRVDAMMU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |