C11H17NO4 — CID 102690138
3-(5-hydroxypentan-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 102690138) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-(5-hydroxypentan-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(5-hydroxypentan-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 102690138 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-(5-hydroxypentan-2-yl)-8-oxa-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC(CCCO)N1C(=O)C2CCC(O2)C1=O |
| InChI | InChI=1S/C11H17NO4/c1-7(3-2-6-13)12-10(14)8-4-5-9(16-8)11(12)15/h7-9,13H,2-6H2,1H3 |
| InChIKey | MYAKEXRQSOSRIC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|