C14H23NO4 — CID 103499678
6-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylheptanoic acid (PubChem CID 103499678) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 6-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylheptanoic acid.
| Compound Name | 6-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylheptanoic acid |
|---|---|
| PubChem CID | 103499678 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 6-(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)N1C(=O)C(C)C(C)C1=O)C(=O)O |
| InChI | InChI=1S/C14H23NO4/c1-8(14(18)19)6-5-7-9(2)15-12(16)10(3)11(4)13(15)17/h8-11H,5-7H2,1-4H3,(H,18,19) |
| InChIKey | DSKQQVCUSMXQGJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|