C11H14N4O3S — CID 102690536
N-(2-aminophenyl)-N-(2-hydroxyethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102690536) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is N-(2-aminophenyl)-N-(2-hydroxyethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-aminophenyl)-N-(2-hydroxyethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102690536 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(2-aminophenyl)-N-(2-hydroxyethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | Nc1ccccc1N(CCO)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C11H14N4O3S/c12-9-3-1-2-4-10(9)15(7-8-16)19(17,18)11-5-6-13-14-11/h1-6,16H,7-8,12H2,(H,13,14) |
| InChIKey | JNWLITWQWQNTMY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|