C10H19N3O4S — CID 102692312
N-(2-methoxyethyl)-N-(3-methoxypropyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692312) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(3-methoxypropyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-N-(3-methoxypropyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692312 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(2-methoxyethyl)-N-(3-methoxypropyl)-1H-pyrazole-5-sulfonamide |
| SMILES | COCCCN(CCOC)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H19N3O4S/c1-16-8-3-6-13(7-9-17-2)18(14,15)10-4-5-11-12-10/h4-5H,3,6-9H2,1-2H3,(H,11,12) |
| InChIKey | GOWQYBHWRQSLIA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|