C10H18N4O2S2 — CID 102691182
3-[2-methylpropyl(1H-pyrazol-5-ylsulfonyl)amino]propanethioamide (PubChem CID 102691182) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-[2-methylpropyl(1H-pyrazol-5-ylsulfonyl)amino]propanethioamide.
| Compound Name | 3-[2-methylpropyl(1H-pyrazol-5-ylsulfonyl)amino]propanethioamide |
|---|---|
| PubChem CID | 102691182 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[2-methylpropyl(1H-pyrazol-5-ylsulfonyl)amino]propanethioamide |
| SMILES | CC(C)CN(CCC(N)=S)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-8(2)7-14(6-4-9(11)17)18(15,16)10-3-5-12-13-10/h3,5,8H,4,6-7H2,1-2H3,(H2,11,17)(H,12,13) |
| InChIKey | OWFUSLDJHSVEQH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|