C9H15N3O4S — CID 102692863
ethyl 2-[ethyl(1H-pyrazol-5-ylsulfonyl)amino]acetate (PubChem CID 102692863) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is ethyl 2-[ethyl(1H-pyrazol-5-ylsulfonyl)amino]acetate.
| Compound Name | ethyl 2-[ethyl(1H-pyrazol-5-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 102692863 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | ethyl 2-[ethyl(1H-pyrazol-5-ylsulfonyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H15N3O4S/c1-3-12(7-9(13)16-4-2)17(14,15)8-5-6-10-11-8/h5-6H,3-4,7H2,1-2H3,(H,10,11) |
| InChIKey | JBRBLSRYMZUYFO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |