C10H16ClN3O2S — CID 102694040
N-[[1-(chloromethyl)cyclopentyl]methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102694040) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopentyl]methyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102694040 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCC1(CCl)CCCC1)c1ccn[nH]1 |
| InChI | InChI=1S/C10H16ClN3O2S/c11-7-10(4-1-2-5-10)8-13-17(15,16)9-3-6-12-14-9/h3,6,13H,1-2,4-5,7-8H2,(H,12,14) |
| InChIKey | QVUNRLPSGXFBOM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|