C21H42O2Si — CID 10269552
2-[(1R)-4-methyl-5-trimethylsilyloxycyclohex-3-en-1-yl]undecan-2-ol (PubChem CID 10269552) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is 2-[(1R)-4-methyl-5-trimethylsilyloxycyclohex-3-en-1-yl]undecan-2-ol.
| Compound Name | 2-[(1R)-4-methyl-5-trimethylsilyloxycyclohex-3-en-1-yl]undecan-2-ol |
|---|---|
| PubChem CID | 10269552 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 2-[(1R)-4-methyl-5-trimethylsilyloxycyclohex-3-en-1-yl]undecan-2-ol |
| SMILES | CCCCCCCCCC(C)(O)[C@@H]1CC=C(C)C(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C21H42O2Si/c1-7-8-9-10-11-12-13-16-21(3,22)19-15-14-18(2)20(17-19)23-24(4,5)6/h14,19-20,22H,7-13,15-17H2,1-6H3/t19-,20?,21?/m1/s1 |
| InChIKey | FOSMNEQAFMUQSM-QNGMFEMESA-N |
| XLogP | 6.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|