C11H24N2O — CID 102697320
1-cyclopentyl-N-(2-methoxypropyl)ethane-1,2-diamine (PubChem CID 102697320) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-cyclopentyl-N-(2-methoxypropyl)ethane-1,2-diamine.
| Compound Name | 1-cyclopentyl-N-(2-methoxypropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102697320 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-cyclopentyl-N-(2-methoxypropyl)ethane-1,2-diamine |
| SMILES | COC(C)CNC(CN)C1CCCC1 |
| InChI | InChI=1S/C11H24N2O/c1-9(14-2)8-13-11(7-12)10-5-3-4-6-10/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | AGHBJBARDWSHQT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |